C22H21F6N7O6 — CID 130335034
[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate (PubChem CID 130335034) has the molecular formula C22H21F6N7O6 and a molecular weight of 593.44 g/mol. Its IUPAC name is [(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 130335034 |
| Molecular Formula | C22H21F6N7O6 |
| Molecular Weight | 593.44 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
| SMILES | NC1=N[C@H]2[C@H](CN3C(=O)CCC3=O)N=C(N)N3C[C@H](OC(=O)c4cc(C(F)(F)F)ccc4C(F)(F)F)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C22H21F6N7O6/c23-21(24,25)8-1-2-10(22(26,27)28)9(5-8)16(38)41-12-7-35-18(30)31-11(6-34-13(36)3-4-14(34)37)15-19(35,20(12,39)40)33-17(29)32-15/h1-2,5,11-12,15,39-40H,3-4,6-7H2,(H2,30,31)(H3,29,32,33)/t11-,12-,15-,19-/m0/s1 |
| InChIKey | YOOKSEJVGUTPAS-UPDUFCCMSA-N |
| XLogP | -0.93 |
| TPSA | 196.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.44 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|