C17H21Cl3N6O5 — CID 130335053
2,2,2-trichloroethyl N-[(3aS,4S,10aS)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-2-methylidene-3,3a,4,8,9,10-hexahydro-1H-pyrrolo[1,2-c]purin-6-yl]carbamate (PubChem CID 130335053) has the molecular formula C17H21Cl3N6O5 and a molecular weight of 495.75 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(3aS,4S,10aS)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-2-methylidene-3,3a,4,8,9,10-hexahydro-1H-pyrrolo[1,2-c]purin-6-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(3aS,4S,10aS)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-2-methylidene-3,3a,4,8,9,10-hexahydro-1H-pyrrolo[1,2-c]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 130335053 |
| Molecular Formula | C17H21Cl3N6O5 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(3aS,4S,10aS)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10-hydroxy-2-methylidene-3,3a,4,8,9,10-hexahydro-1H-pyrrolo[1,2-c]purin-6-yl]carbamate |
| SMILES | C=C1N[C@H]2[C@H](CN3C(=O)CCC3=O)N=C(NC(=O)OCC(Cl)(Cl)Cl)N3CCC(O)[C@]23N1 |
| InChI | InChI=1S/C17H21Cl3N6O5/c1-8-21-13-9(6-25-11(28)2-3-12(25)29)22-14(23-15(30)31-7-16(18,19)20)26-5-4-10(27)17(13,26)24-8/h9-10,13,21,24,27H,1-7H2,(H,22,23,30)/t9-,10?,13-,17+/m0/s1 |
| InChIKey | IXANSXOSGLUGLS-LBKMEWHBSA-N |
| XLogP | -0.23 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|