About (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine
(Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine (PubChem CID 130335237) has the molecular formula C5H11N3
and a molecular weight of 113.16 g/mol. Its IUPAC name is (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine |
| PubChem CID | 130335237 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine |
| SMILES | [H]/N=N/C(C)=C\N(C)C |
| InChI | InChI=1S/C5H11N3/c1-5(7-6)4-8(2)3/h4,6H,1-3H3/b5-4-,7-6+ |
| InChIKey | NHZGQNJPBHERFH-SCFJQAPRSA-N |
| XLogP | 1.44 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine?
The IUPAC name of (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine (CID 130335237) is (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine.
What is the SMILES notation for (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine?
The canonical SMILES for (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine is [H]/N=N/C(C)=C\N(C)C.
What is the InChIKey of (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine?
The InChIKey is NHZGQNJPBHERFH-SCFJQAPRSA-N. The full InChI is InChI=1S/C5H11N3/c1-5(7-6)4-8(2)3/h4,6H,1-3H3/b5-4-,7-6+.
What are the key properties of (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine?
(Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine has a molecular weight of 113.16 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-diazenyl-N,N-dimethylprop-1-en-1-amine is sourced from PubChem (CID 130335237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).