C16H14O7 — CID 130335412
4-methyl-2-(3,4,5-trihydroxyphenyl)-4H-chromene-3,5,7-triol (PubChem CID 130335412) has the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. Its IUPAC name is 4-methyl-2-(3,4,5-trihydroxyphenyl)-4H-chromene-3,5,7-triol.
| Compound Name | 4-methyl-2-(3,4,5-trihydroxyphenyl)-4H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 130335412 |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-methyl-2-(3,4,5-trihydroxyphenyl)-4H-chromene-3,5,7-triol |
| SMILES | CC1C(O)=C(c2cc(O)c(O)c(O)c2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C16H14O7/c1-6-13-9(18)4-8(17)5-12(13)23-16(14(6)21)7-2-10(19)15(22)11(20)3-7/h2-6,17-22H,1H3 |
| InChIKey | WCUILXFXCIWKQC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|