C15H11F3N4O2 — CID 130335540
N-[(3-nitrophenyl)methyl]-6-(trifluoromethyl)-1H-indazol-4-amine (PubChem CID 130335540) has the molecular formula C15H11F3N4O2 and a molecular weight of 336.27 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methyl]-6-(trifluoromethyl)-1H-indazol-4-amine.
| Compound Name | N-[(3-nitrophenyl)methyl]-6-(trifluoromethyl)-1H-indazol-4-amine |
|---|---|
| PubChem CID | 130335540 |
| Molecular Formula | C15H11F3N4O2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[(3-nitrophenyl)methyl]-6-(trifluoromethyl)-1H-indazol-4-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2cc(C(F)(F)F)cc3[nH]ncc23)c1 |
| InChI | InChI=1S/C15H11F3N4O2/c16-15(17,18)10-5-13(12-8-20-21-14(12)6-10)19-7-9-2-1-3-11(4-9)22(23)24/h1-6,8,19H,7H2,(H,20,21) |
| InChIKey | HAQHXRVCQGZKTN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|