C16H20F6INO3 — CID 130335861
[5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]methyl 2-(aziridin-2-yl)-2-iodoacetate (PubChem CID 130335861) has the molecular formula C16H20F6INO3 and a molecular weight of 515.23 g/mol. Its IUPAC name is [5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]methyl 2-(aziridin-2-yl)-2-iodoacetate.
| Compound Name | [5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]methyl 2-(aziridin-2-yl)-2-iodoacetate |
|---|---|
| PubChem CID | 130335861 |
| Molecular Formula | C16H20F6INO3 |
| Molecular Weight | 515.23 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | [5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]methyl 2-(aziridin-2-yl)-2-iodoacetate |
| SMILES | O=C(OCC1CC2CC1CC2CC(O)(C(F)(F)F)C(F)(F)F)C(I)C1CN1 |
| InChI | InChI=1S/C16H20F6INO3/c17-15(18,19)14(26,16(20,21)22)4-9-2-8-1-7(9)3-10(8)6-27-13(25)12(23)11-5-24-11/h7-12,24,26H,1-6H2 |
| InChIKey | WMWLFYLGVSYFMM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|