C24H31FN4O4S2 — CID 130335927
1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[3-(dimethylsulfamoyl)phenyl]methyl]-N,N,2-trimethylindole-5-sulfonamide (PubChem CID 130335927) has the molecular formula C24H31FN4O4S2 and a molecular weight of 522.67 g/mol. Its IUPAC name is 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[3-(dimethylsulfamoyl)phenyl]methyl]-N,N,2-trimethylindole-5-sulfonamide.
| Compound Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[3-(dimethylsulfamoyl)phenyl]methyl]-N,N,2-trimethylindole-5-sulfonamide |
|---|---|
| PubChem CID | 130335927 |
| Molecular Formula | C24H31FN4O4S2 |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[[3-(dimethylsulfamoyl)phenyl]methyl]-N,N,2-trimethylindole-5-sulfonamide |
| SMILES | Cc1c(Cc2cccc(S(=O)(=O)N(C)C)c2)c2cc(S(=O)(=O)N(C)C)ccc2n1C/C(F)=C/CN |
| InChI | InChI=1S/C24H31FN4O4S2/c1-17-22(14-18-7-6-8-20(13-18)34(30,31)27(2)3)23-15-21(35(32,33)28(4)5)9-10-24(23)29(17)16-19(25)11-12-26/h6-11,13,15H,12,14,16,26H2,1-5H3/b19-11- |
| InChIKey | GREZYWHAPQLZSP-ODLFYWEKSA-N |
| XLogP | 2.85 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|