About 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine
4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine (PubChem CID 130335993) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine |
| PubChem CID | 130335993 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine |
| SMILES | CCc1nc(C(C)C)nc2oncc12 |
| InChI | InChI=1S/C10H13N3O/c1-4-8-7-5-11-14-10(7)13-9(12-8)6(2)3/h5-6H,4H2,1-3H3 |
| InChIKey | NECCLIZEUKSGLM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine?
The IUPAC name of 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine (CID 130335993) is 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine.
What is the SMILES notation for 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine?
The canonical SMILES for 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine is CCc1nc(C(C)C)nc2oncc12.
What is the InChIKey of 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine?
The InChIKey is NECCLIZEUKSGLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-4-8-7-5-11-14-10(7)13-9(12-8)6(2)3/h5-6H,4H2,1-3H3.
What are the key properties of 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine?
4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine has a molecular weight of 191.23 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-propan-2-yl-[1,2]oxazolo[5,4-d]pyrimidine is sourced from PubChem (CID 130335993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).