About 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol
1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol (PubChem CID 130336162) has the molecular formula C20H29F3N2O2
and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol.
Molecular Properties
| Compound Name | 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol |
| PubChem CID | 130336162 |
| Molecular Formula | C20H29F3N2O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol |
| SMILES | CC(O)NC1CCCNC1COC1CCC(c2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C20H29F3N2O2/c1-12(26)25-17-3-2-10-24-18(17)11-27-14-6-4-13(5-7-14)19-15(21)8-9-16(22)20(19)23/h8-9,12-14,17-18,24-26H,2-7,10-11H2,1H3 |
| InChIKey | RMWGDCWKWJKIOQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol?
The IUPAC name of 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol (CID 130336162) is 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol.
What is the SMILES notation for 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol?
The canonical SMILES for 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol is CC(O)NC1CCCNC1COC1CCC(c2c(F)ccc(F)c2F)CC1.
What is the InChIKey of 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol?
The InChIKey is RMWGDCWKWJKIOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29F3N2O2/c1-12(26)25-17-3-2-10-24-18(17)11-27-14-6-4-13(5-7-14)19-15(21)8-9-16(22)20(19)23/h8-9,12-14,17-18,24-26H,2-7,10-11H2,1H3.
What are the key properties of 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol?
1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol has a molecular weight of 386.46 g/mol, XLogP of 3.20, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]amino]ethanol is sourced from PubChem (CID 130336162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).