C22H35N3O4S — CID 130336178
(2R)-1-acetyl-3-(dimethylsulfamoylamino)-2-[(4-phenylcyclohexyl)oxymethyl]piperidine (PubChem CID 130336178) has the molecular formula C22H35N3O4S and a molecular weight of 437.61 g/mol. Its IUPAC name is (2R)-1-acetyl-3-(dimethylsulfamoylamino)-2-[(4-phenylcyclohexyl)oxymethyl]piperidine.
| Compound Name | (2R)-1-acetyl-3-(dimethylsulfamoylamino)-2-[(4-phenylcyclohexyl)oxymethyl]piperidine |
|---|---|
| PubChem CID | 130336178 |
| Molecular Formula | C22H35N3O4S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (2R)-1-acetyl-3-(dimethylsulfamoylamino)-2-[(4-phenylcyclohexyl)oxymethyl]piperidine |
| SMILES | CC(=O)N1CCCC(NS(=O)(=O)N(C)C)[C@@H]1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H35N3O4S/c1-17(26)25-15-7-10-21(23-30(27,28)24(2)3)22(25)16-29-20-13-11-19(12-14-20)18-8-5-4-6-9-18/h4-6,8-9,19-23H,7,10-16H2,1-3H3/t19?,20?,21?,22-/m0/s1 |
| InChIKey | SDLBPXVIISIXMJ-YTZNMQJJSA-N |
| XLogP | 2.50 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |