About (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine
(2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine (PubChem CID 130336293) has the molecular formula C18H26F2N2O
and a molecular weight of 324.42 g/mol. Its IUPAC name is (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine.
Molecular Properties
| Compound Name | (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine |
| PubChem CID | 130336293 |
| Molecular Formula | C18H26F2N2O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine |
| SMILES | NC1CCCN[C@H]1COC1CCC(c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C18H26F2N2O/c19-14-3-1-4-15(20)18(14)12-6-8-13(9-7-12)23-11-17-16(21)5-2-10-22-17/h1,3-4,12-13,16-17,22H,2,5-11,21H2/t12?,13?,16?,17-/m0/s1 |
| InChIKey | SNXSKFWZQZHLLJ-AMCGCOJJSA-N |
| XLogP | 3.09 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine?
The IUPAC name of (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine (CID 130336293) is (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine.
What is the SMILES notation for (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine?
The canonical SMILES for (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine is NC1CCCN[C@H]1COC1CCC(c2c(F)cccc2F)CC1.
What is the InChIKey of (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine?
The InChIKey is SNXSKFWZQZHLLJ-AMCGCOJJSA-N. The full InChI is InChI=1S/C18H26F2N2O/c19-14-3-1-4-15(20)18(14)12-6-8-13(9-7-12)23-11-17-16(21)5-2-10-22-17/h1,3-4,12-13,16-17,22H,2,5-11,21H2/t12?,13?,16?,17-/m0/s1.
What are the key properties of (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine?
(2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine has a molecular weight of 324.42 g/mol, XLogP of 3.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]piperidin-3-amine is sourced from PubChem (CID 130336293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).