C19H28F2N2OS — CID 130336294
(2R,3S)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]-N-methylsulfanylpiperidin-3-amine (PubChem CID 130336294) has the molecular formula C19H28F2N2OS and a molecular weight of 370.51 g/mol. Its IUPAC name is (2R,3S)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]-N-methylsulfanylpiperidin-3-amine.
| Compound Name | (2R,3S)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]-N-methylsulfanylpiperidin-3-amine |
|---|---|
| PubChem CID | 130336294 |
| Molecular Formula | C19H28F2N2OS |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (2R,3S)-2-[[4-(2,6-difluorophenyl)cyclohexyl]oxymethyl]-N-methylsulfanylpiperidin-3-amine |
| SMILES | CSN[C@H]1CCCN[C@H]1COC1CCC(c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H28F2N2OS/c1-25-23-17-6-3-11-22-18(17)12-24-14-9-7-13(8-10-14)19-15(20)4-2-5-16(19)21/h2,4-5,13-14,17-18,22-23H,3,6-12H2,1H3/t13?,14?,17-,18-/m0/s1 |
| InChIKey | UUCPPSJOZOJBBZ-GNNGFNCTSA-N |
| XLogP | 4.00 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|