About 6-methanimidoyl-1,2-dihydropyridin-5-amine
6-methanimidoyl-1,2-dihydropyridin-5-amine (PubChem CID 130336519) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 6-methanimidoyl-1,2-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | 6-methanimidoyl-1,2-dihydropyridin-5-amine |
| PubChem CID | 130336519 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 6-methanimidoyl-1,2-dihydropyridin-5-amine |
| SMILES | [H]/N=C/C1=C(N)C=CCN1 |
| InChI | InChI=1S/C6H9N3/c7-4-6-5(8)2-1-3-9-6/h1-2,4,7,9H,3,8H2/b7-4+ |
| InChIKey | WJOAVXAADOWCNW-QPJJXVBHSA-N |
| XLogP | -0.03 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methanimidoyl-1,2-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methanimidoyl-1,2-dihydropyridin-5-amine?
The IUPAC name of 6-methanimidoyl-1,2-dihydropyridin-5-amine (CID 130336519) is 6-methanimidoyl-1,2-dihydropyridin-5-amine.
What is the SMILES notation for 6-methanimidoyl-1,2-dihydropyridin-5-amine?
The canonical SMILES for 6-methanimidoyl-1,2-dihydropyridin-5-amine is [H]/N=C/C1=C(N)C=CCN1.
What is the InChIKey of 6-methanimidoyl-1,2-dihydropyridin-5-amine?
The InChIKey is WJOAVXAADOWCNW-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H9N3/c7-4-6-5(8)2-1-3-9-6/h1-2,4,7,9H,3,8H2/b7-4+.
What are the key properties of 6-methanimidoyl-1,2-dihydropyridin-5-amine?
6-methanimidoyl-1,2-dihydropyridin-5-amine has a molecular weight of 123.16 g/mol, XLogP of -0.03, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methanimidoyl-1,2-dihydropyridin-5-amine is sourced from PubChem (CID 130336519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).