About (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide
(E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide (PubChem CID 130336616) has the molecular formula C7H11FN2
and a molecular weight of 142.18 g/mol. Its IUPAC name is (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide.
Molecular Properties
| Compound Name | (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide |
| PubChem CID | 130336616 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide |
| SMILES | C=C(C)/N=C(N)/C(F)=C\C |
| InChI | InChI=1S/C7H11FN2/c1-4-6(8)7(9)10-5(2)3/h4H,2H2,1,3H3,(H2,9,10)/b6-4+ |
| InChIKey | PAQCEWTUIKDJTQ-GQCTYLIASA-N |
| XLogP | 1.75 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide?
The IUPAC name of (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide (CID 130336616) is (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide.
What is the SMILES notation for (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide?
The canonical SMILES for (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide is C=C(C)/N=C(N)/C(F)=C\C.
What is the InChIKey of (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide?
The InChIKey is PAQCEWTUIKDJTQ-GQCTYLIASA-N. The full InChI is InChI=1S/C7H11FN2/c1-4-6(8)7(9)10-5(2)3/h4H,2H2,1,3H3,(H2,9,10)/b6-4+.
What are the key properties of (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide?
(E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide has a molecular weight of 142.18 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-fluoro-N'-prop-1-en-2-ylbut-2-enimidamide is sourced from PubChem (CID 130336616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).