About 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine
6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine (PubChem CID 130336662) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine |
| PubChem CID | 130336662 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine |
| SMILES | CC(C)c1cc(C(C)C)c2ncncc2n1 |
| InChI | InChI=1S/C13H17N3/c1-8(2)10-5-11(9(3)4)16-12-6-14-7-15-13(10)12/h5-9H,1-4H3 |
| InChIKey | VOEXNBHMIHIXAT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine?
The IUPAC name of 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine (CID 130336662) is 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine.
What is the SMILES notation for 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine?
The canonical SMILES for 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine is CC(C)c1cc(C(C)C)c2ncncc2n1.
What is the InChIKey of 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine?
The InChIKey is VOEXNBHMIHIXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-8(2)10-5-11(9(3)4)16-12-6-14-7-15-13(10)12/h5-9H,1-4H3.
What are the key properties of 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine?
6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine has a molecular weight of 215.30 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-di(propan-2-yl)pyrido[3,2-d]pyrimidine is sourced from PubChem (CID 130336662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).