C33H44FN3 — CID 130336985
7-N-[(3E,6Z)-2-[C-(3-fluoro-2,5-dimethylphenyl)-N-methylcarbonimidoyl]-5-propan-2-ylideneocta-1,3,6-trien-4-yl]-6-prop-1-en-2-yltricyclo[3.2.2.02,4]nonane-2,7-diamine (PubChem CID 130336985) has the molecular formula C33H44FN3 and a molecular weight of 501.73 g/mol. Its IUPAC name is 7-N-[(3E,6Z)-2-[C-(3-fluoro-2,5-dimethylphenyl)-N-methylcarbonimidoyl]-5-propan-2-ylideneocta-1,3,6-trien-4-yl]-6-prop-1-en-2-yltricyclo[3.2.2.02,4]nonane-2,7-diamine.
| Compound Name | 7-N-[(3E,6Z)-2-[C-(3-fluoro-2,5-dimethylphenyl)-N-methylcarbonimidoyl]-5-propan-2-ylideneocta-1,3,6-trien-4-yl]-6-prop-1-en-2-yltricyclo[3.2.2.02,4]nonane-2,7-diamine |
|---|---|
| PubChem CID | 130336985 |
| Molecular Formula | C33H44FN3 |
| Molecular Weight | 501.73 g/mol |
| Exact Mass | 501.35 |
| IUPAC Name | 7-N-[(3E,6Z)-2-[C-(3-fluoro-2,5-dimethylphenyl)-N-methylcarbonimidoyl]-5-propan-2-ylideneocta-1,3,6-trien-4-yl]-6-prop-1-en-2-yltricyclo[3.2.2.02,4]nonane-2,7-diamine |
| SMILES | C=C(/C=C(/NC1C(C(=C)C)C2CCC1C1(N)CC21)C(/C=C\C)=C(C)C)/C(=N/C)c1cc(C)cc(F)c1C |
| InChI | InChI=1S/C33H44FN3/c1-10-11-23(18(2)3)29(16-21(7)31(36-9)25-14-20(6)15-28(34)22(25)8)37-32-26-13-12-24(30(32)19(4)5)27-17-33(26,27)35/h10-11,14-16,24,26-27,30,32,37H,4,7,12-13,17,35H2,1-3,5-6,8-9H3/b11-10-,29-16+,36-31- |
| InChIKey | VJTYEJIGJQOYBL-ARNITKSHSA-N |
| XLogP | 7.12 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|