C16H28O5 — CID 130337250
(1S,4R,5S,8R,9S,14R)-4,8,12-trimethyl-14-methylperoxy-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-ol (PubChem CID 130337250) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is (1S,4R,5S,8R,9S,14R)-4,8,12-trimethyl-14-methylperoxy-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-ol.
| Compound Name | (1S,4R,5S,8R,9S,14R)-4,8,12-trimethyl-14-methylperoxy-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-ol |
|---|---|
| PubChem CID | 130337250 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (1S,4R,5S,8R,9S,14R)-4,8,12-trimethyl-14-methylperoxy-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-ol |
| SMILES | COO[C@]12[C@H]3OC(C)CC[C@H]1[C@H](C)CC[C@H]2[C@@H](C)C(O)O3 |
| InChI | InChI=1S/C16H28O5/c1-9-5-7-13-11(3)14(17)20-15-16(13,21-18-4)12(9)8-6-10(2)19-15/h9-15,17H,5-8H2,1-4H3/t9-,10?,11-,12+,13+,14?,15+,16-/m1/s1 |
| InChIKey | WBFYCSLEMBMDEO-XRMHFXJGSA-N |
| XLogP | 2.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|