C11H17N — CID 130337306
(5S,7R)-3,5,7-trimethyl-4,5,6,7-tetrahydro-3H-cyclopenta[c]pyridine (PubChem CID 130337306) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (5S,7R)-3,5,7-trimethyl-4,5,6,7-tetrahydro-3H-cyclopenta[c]pyridine.
| Compound Name | (5S,7R)-3,5,7-trimethyl-4,5,6,7-tetrahydro-3H-cyclopenta[c]pyridine |
|---|---|
| PubChem CID | 130337306 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (5S,7R)-3,5,7-trimethyl-4,5,6,7-tetrahydro-3H-cyclopenta[c]pyridine |
| SMILES | CC1CC2=C(C=N1)[C@H](C)C[C@@H]2C |
| InChI | InChI=1S/C11H17N/c1-7-4-8(2)11-6-12-9(3)5-10(7)11/h6-9H,4-5H2,1-3H3/t7-,8+,9?/m0/s1 |
| InChIKey | OJENSTNTGIPLJA-ZQTLJVIJSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |