C9H16N4 — CID 130337509
(3Z)-4-N-ethenyl-5-(ethylideneamino)penta-1,3-diene-2,3,4-triamine (PubChem CID 130337509) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3Z)-4-N-ethenyl-5-(ethylideneamino)penta-1,3-diene-2,3,4-triamine.
| Compound Name | (3Z)-4-N-ethenyl-5-(ethylideneamino)penta-1,3-diene-2,3,4-triamine |
|---|---|
| PubChem CID | 130337509 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | (3Z)-4-N-ethenyl-5-(ethylideneamino)penta-1,3-diene-2,3,4-triamine |
| SMILES | C=CN/C(C/N=C/C)=C(\N)C(=C)N |
| InChI | InChI=1S/C9H16N4/c1-4-12-6-8(13-5-2)9(11)7(3)10/h4-5,13H,2-3,6,10-11H2,1H3/b9-8-,12-4+ |
| InChIKey | JJJBHIWIHLUSSL-FIYMPXMFSA-N |
| XLogP | 0.45 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|