C20H17N7O2S — CID 130337561
9-[1-(1,1-dioxo-2-phenyl-1λ6,2,4-benzothiadiazin-3-yl)ethyl]purin-6-amine (PubChem CID 130337561) has the molecular formula C20H17N7O2S and a molecular weight of 419.47 g/mol. Its IUPAC name is 9-[1-(1,1-dioxo-2-phenyl-1λ6,2,4-benzothiadiazin-3-yl)ethyl]purin-6-amine.
| Compound Name | 9-[1-(1,1-dioxo-2-phenyl-1λ6,2,4-benzothiadiazin-3-yl)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 130337561 |
| Molecular Formula | C20H17N7O2S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 9-[1-(1,1-dioxo-2-phenyl-1λ6,2,4-benzothiadiazin-3-yl)ethyl]purin-6-amine |
| SMILES | CC(C1=Nc2ccccc2S(=O)(=O)N1c1ccccc1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H17N7O2S/c1-13(26-12-24-17-18(21)22-11-23-20(17)26)19-25-15-9-5-6-10-16(15)30(28,29)27(19)14-7-3-2-4-8-14/h2-13H,1H3,(H2,21,22,23) |
| InChIKey | LBIWHPFCTHZQKZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |