C27H31F3N6O3S — CID 130337793
4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidine-1-carboximidamide (PubChem CID 130337793) has the molecular formula C27H31F3N6O3S and a molecular weight of 576.65 g/mol. Its IUPAC name is 4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidine-1-carboximidamide.
| Compound Name | 4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 130337793 |
| Molecular Formula | C27H31F3N6O3S |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(Nc2cccc3c2cc(C#CCNc2ccc(S(C)(=O)=O)cc2OC)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C27H31F3N6O3S/c1-39-25-16-20(40(2,37)38)8-9-23(25)33-12-4-5-19-15-21-22(34-18-10-13-35(14-11-18)26(31)32)6-3-7-24(21)36(19)17-27(28,29)30/h3,6-9,15-16,18,33-34H,10-14,17H2,1-2H3,(H3,31,32) |
| InChIKey | NFFBOGREEYSBQH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|