C27H28F3N3O4 — CID 130337827
methyl 3-methoxy-4-[3-[4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzoate (PubChem CID 130337827) has the molecular formula C27H28F3N3O4 and a molecular weight of 515.53 g/mol. Its IUPAC name is methyl 3-methoxy-4-[3-[4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzoate.
| Compound Name | methyl 3-methoxy-4-[3-[4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzoate |
|---|---|
| PubChem CID | 130337827 |
| Molecular Formula | C27H28F3N3O4 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | methyl 3-methoxy-4-[3-[4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCC#Cc2cc3c(NC4CCOCC4)cccc3n2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C27H28F3N3O4/c1-35-25-15-18(26(34)36-2)8-9-23(25)31-12-4-5-20-16-21-22(32-19-10-13-37-14-11-19)6-3-7-24(21)33(20)17-27(28,29)30/h3,6-9,15-16,19,31-32H,10-14,17H2,1-2H3 |
| InChIKey | LSMFIDYAEQNHNO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|