C29H34F3N3O3S — CID 130337830
2-[3-(4-tert-butyl-2-methoxyanilino)prop-1-ynyl]-N-(1,1-dioxothian-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 130337830) has the molecular formula C29H34F3N3O3S and a molecular weight of 561.67 g/mol. Its IUPAC name is 2-[3-(4-tert-butyl-2-methoxyanilino)prop-1-ynyl]-N-(1,1-dioxothian-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-(4-tert-butyl-2-methoxyanilino)prop-1-ynyl]-N-(1,1-dioxothian-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 130337830 |
| Molecular Formula | C29H34F3N3O3S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 2-[3-(4-tert-butyl-2-methoxyanilino)prop-1-ynyl]-N-(1,1-dioxothian-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | COc1cc(C(C)(C)C)ccc1NCC#Cc1cc2c(NC3CCS(=O)(=O)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C29H34F3N3O3S/c1-28(2,3)20-10-11-25(27(17-20)38-4)33-14-6-7-22-18-23-24(34-21-12-15-39(36,37)16-13-21)8-5-9-26(23)35(22)19-29(30,31)32/h5,8-11,17-18,21,33-34H,12-16,19H2,1-4H3 |
| InChIKey | PLEGOIFWXTUNPW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|