C27H30F3N3O5S2 — CID 130337837
N-(1,1-dioxothian-4-yl)-2-[3-(2-ethoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 130337837) has the molecular formula C27H30F3N3O5S2 and a molecular weight of 597.68 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2-[3-(2-ethoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-2-[3-(2-ethoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 130337837 |
| Molecular Formula | C27H30F3N3O5S2 |
| Molecular Weight | 597.68 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2-[3-(2-ethoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CCOc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(NC3CCS(=O)(=O)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C27H30F3N3O5S2/c1-3-38-26-17-21(39(2,34)35)9-10-24(26)31-13-5-6-20-16-22-23(32-19-11-14-40(36,37)15-12-19)7-4-8-25(22)33(20)18-27(28,29)30/h4,7-10,16-17,19,31-32H,3,11-15,18H2,1-2H3 |
| InChIKey | QFSDRSZPRSLXDC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|