C30H37F3N4O5S — CID 130337853
2-[2-[4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethoxy]ethanol (PubChem CID 130337853) has the molecular formula C30H37F3N4O5S and a molecular weight of 622.71 g/mol. Its IUPAC name is 2-[2-[4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 130337853 |
| Molecular Formula | C30H37F3N4O5S |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 2-[2-[4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethoxy]ethanol |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(NC3CCN(CCOCCO)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C30H37F3N4O5S/c1-41-29-20-24(43(2,39)40)8-9-27(29)34-12-4-5-23-19-25-26(6-3-7-28(25)37(23)21-30(31,32)33)35-22-10-13-36(14-11-22)15-17-42-18-16-38/h3,6-9,19-20,22,34-35,38H,10-18,21H2,1-2H3 |
| InChIKey | JFNYNJINIDZAFY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|