C27H30F3N5O2 — CID 130337997
3-methoxy-4-[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide (PubChem CID 130337997) has the molecular formula C27H30F3N5O2 and a molecular weight of 513.56 g/mol. Its IUPAC name is 3-methoxy-4-[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide.
| Compound Name | 3-methoxy-4-[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide |
|---|---|
| PubChem CID | 130337997 |
| Molecular Formula | C27H30F3N5O2 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 3-methoxy-4-[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide |
| SMILES | COc1cc(C(N)=O)ccc1NCC#Cc1cc2c(NC3CCN(C)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C27H30F3N5O2/c1-34-13-10-19(11-14-34)33-22-6-3-7-24-21(22)16-20(35(24)17-27(28,29)30)5-4-12-32-23-9-8-18(26(31)36)15-25(23)37-2/h3,6-9,15-16,19,32-33H,10-14,17H2,1-2H3,(H2,31,36) |
| InChIKey | PLNMJMFVRZJYIC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|