C33H41F3N4O5S — CID 130337999
2-[3-[2-(2-methoxyethoxy)-4-methylsulfonylanilino]prop-1-ynyl]-N-[1-(oxan-4-yl)piperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 130337999) has the molecular formula C33H41F3N4O5S and a molecular weight of 662.78 g/mol. Its IUPAC name is 2-[3-[2-(2-methoxyethoxy)-4-methylsulfonylanilino]prop-1-ynyl]-N-[1-(oxan-4-yl)piperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-[2-(2-methoxyethoxy)-4-methylsulfonylanilino]prop-1-ynyl]-N-[1-(oxan-4-yl)piperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 130337999 |
| Molecular Formula | C33H41F3N4O5S |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | 2-[3-[2-(2-methoxyethoxy)-4-methylsulfonylanilino]prop-1-ynyl]-N-[1-(oxan-4-yl)piperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | COCCOc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(NC3CCN(C4CCOCC4)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C33H41F3N4O5S/c1-43-19-20-45-32-22-27(46(2,41)42)8-9-30(32)37-14-4-5-26-21-28-29(6-3-7-31(28)40(26)23-33(34,35)36)38-24-10-15-39(16-11-24)25-12-17-44-18-13-25/h3,6-9,21-22,24-25,37-38H,10-20,23H2,1-2H3 |
| InChIKey | GTRWCPVMURAYGA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|