C31H37F3N4O5S — CID 130338006
(3S,4S)-1-[4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]cyclohexyl]pyrrolidine-3,4-diol (PubChem CID 130338006) has the molecular formula C31H37F3N4O5S and a molecular weight of 634.72 g/mol. Its IUPAC name is (3S,4S)-1-[4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]cyclohexyl]pyrrolidine-3,4-diol.
| Compound Name | (3S,4S)-1-[4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]cyclohexyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 130338006 |
| Molecular Formula | C31H37F3N4O5S |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | (3S,4S)-1-[4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]cyclohexyl]pyrrolidine-3,4-diol |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(NC3CCC(N4C[C@H](O)[C@@H](O)C4)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C31H37F3N4O5S/c1-43-30-16-23(44(2,41)42)12-13-26(30)35-14-4-5-22-15-24-25(6-3-7-27(24)38(22)19-31(32,33)34)36-20-8-10-21(11-9-20)37-17-28(39)29(40)18-37/h3,6-7,12-13,15-16,20-21,28-29,35-36,39-40H,8-11,14,17-19H2,1-2H3/t20?,21?,28-,29-/m0/s1 |
| InChIKey | WNAOSPWHLMTKEG-FJCIWQQLSA-N |
| XLogP | 3.84 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|