C25H25F4N3O3S — CID 130338118
N-(1,1-dioxothian-4-yl)-2-[3-(4-fluoro-2-methoxyanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 130338118) has the molecular formula C25H25F4N3O3S and a molecular weight of 523.55 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2-[3-(4-fluoro-2-methoxyanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-2-[3-(4-fluoro-2-methoxyanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 130338118 |
| Molecular Formula | C25H25F4N3O3S |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2-[3-(4-fluoro-2-methoxyanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | COc1cc(F)ccc1NCC#Cc1cc2c(NC3CCS(=O)(=O)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C25H25F4N3O3S/c1-35-24-14-17(26)7-8-22(24)30-11-3-4-19-15-20-21(31-18-9-12-36(33,34)13-10-18)5-2-6-23(20)32(19)16-25(27,28)29/h2,5-8,14-15,18,30-31H,9-13,16H2,1H3 |
| InChIKey | XXCKTMRCZGRSKP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|