C31H36F3N5O3 — CID 130338333
3-methoxy-4-[3-[4-[[1-(oxan-4-yl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide (PubChem CID 130338333) has the molecular formula C31H36F3N5O3 and a molecular weight of 583.66 g/mol. Its IUPAC name is 3-methoxy-4-[3-[4-[[1-(oxan-4-yl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide.
| Compound Name | 3-methoxy-4-[3-[4-[[1-(oxan-4-yl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide |
|---|---|
| PubChem CID | 130338333 |
| Molecular Formula | C31H36F3N5O3 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 3-methoxy-4-[3-[4-[[1-(oxan-4-yl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide |
| SMILES | COc1cc(C(N)=O)ccc1NCC#Cc1cc2c(NC3CCN(C4CCOCC4)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C31H36F3N5O3/c1-41-29-18-21(30(35)40)7-8-27(29)36-13-3-4-24-19-25-26(5-2-6-28(25)39(24)20-31(32,33)34)37-22-9-14-38(15-10-22)23-11-16-42-17-12-23/h2,5-8,18-19,22-23,36-37H,9-17,20H2,1H3,(H2,35,40) |
| InChIKey | ZMUIISKFBGJVQY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|