C9H5F3IN3O2 — CID 130338455
2-iodo-4-nitro-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine (PubChem CID 130338455) has the molecular formula C9H5F3IN3O2 and a molecular weight of 371.06 g/mol. Its IUPAC name is 2-iodo-4-nitro-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine.
| Compound Name | 2-iodo-4-nitro-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 130338455 |
| Molecular Formula | C9H5F3IN3O2 |
| Molecular Weight | 371.06 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 2-iodo-4-nitro-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine |
| SMILES | O=[N+]([O-])c1ccnc2c1cc(I)n2CC(F)(F)F |
| InChI | InChI=1S/C9H5F3IN3O2/c10-9(11,12)4-15-7(13)3-5-6(16(17)18)1-2-14-8(5)15/h1-3H,4H2 |
| InChIKey | DXAPTRBHWWULOE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.06 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|