C26H26F3N3O4 — CID 130338488
3-methoxy-4-[3-[4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzoic acid (PubChem CID 130338488) has the molecular formula C26H26F3N3O4 and a molecular weight of 501.51 g/mol. Its IUPAC name is 3-methoxy-4-[3-[4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzoic acid.
| Compound Name | 3-methoxy-4-[3-[4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzoic acid |
|---|---|
| PubChem CID | 130338488 |
| Molecular Formula | C26H26F3N3O4 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 3-methoxy-4-[3-[4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NCC#Cc1cc2c(NC3CCOCC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C26H26F3N3O4/c1-35-24-14-17(25(33)34)7-8-22(24)30-11-3-4-19-15-20-21(31-18-9-12-36-13-10-18)5-2-6-23(20)32(19)16-26(27,28)29/h2,5-8,14-15,18,30-31H,9-13,16H2,1H3,(H,33,34) |
| InChIKey | IVVQEVJNPZFNGN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|