C20H26F3N3O3S — CID 130338500
tert-butyl N-(oxan-4-yl)-N-[[2-sulfanylidene-1-(2,2,2-trifluoroethyl)-3H-benzimidazol-5-yl]methyl]carbamate (PubChem CID 130338500) has the molecular formula C20H26F3N3O3S and a molecular weight of 445.51 g/mol. Its IUPAC name is tert-butyl N-(oxan-4-yl)-N-[[2-sulfanylidene-1-(2,2,2-trifluoroethyl)-3H-benzimidazol-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-(oxan-4-yl)-N-[[2-sulfanylidene-1-(2,2,2-trifluoroethyl)-3H-benzimidazol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 130338500 |
| Molecular Formula | C20H26F3N3O3S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | tert-butyl N-(oxan-4-yl)-N-[[2-sulfanylidene-1-(2,2,2-trifluoroethyl)-3H-benzimidazol-5-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc2c(c1)[nH]c(=S)n2CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C20H26F3N3O3S/c1-19(2,3)29-18(27)25(14-6-8-28-9-7-14)11-13-4-5-16-15(10-13)24-17(30)26(16)12-20(21,22)23/h4-5,10,14H,6-9,11-12H2,1-3H3,(H,24,30) |
| InChIKey | DWUJVKNVIBCQEJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|