C27H30F3N5O3S2 — CID 130338555
4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidine-1-carbothioamide (PubChem CID 130338555) has the molecular formula C27H30F3N5O3S2 and a molecular weight of 593.70 g/mol. Its IUPAC name is 4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidine-1-carbothioamide.
| Compound Name | 4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 130338555 |
| Molecular Formula | C27H30F3N5O3S2 |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidine-1-carbothioamide |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(NC3CCN(C(N)=S)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C27H30F3N5O3S2/c1-38-25-16-20(40(2,36)37)8-9-23(25)32-12-4-5-19-15-21-22(33-18-10-13-34(14-11-18)26(31)39)6-3-7-24(21)35(19)17-27(28,29)30/h3,6-9,15-16,18,32-33H,10-14,17H2,1-2H3,(H2,31,39) |
| InChIKey | UGYICENEKJJFAQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|