C12H16OS2 — CID 13033862
7'a-methylspiro[1,3-dithiolane-2,5'-2,3,6,7-tetrahydroindene]-1'-one (PubChem CID 13033862) has the molecular formula C12H16OS2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 7'a-methylspiro[1,3-dithiolane-2,5'-2,3,6,7-tetrahydroindene]-1'-one.
| Compound Name | 7'a-methylspiro[1,3-dithiolane-2,5'-2,3,6,7-tetrahydroindene]-1'-one |
|---|---|
| PubChem CID | 13033862 |
| Molecular Formula | C12H16OS2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 7'a-methylspiro[1,3-dithiolane-2,5'-2,3,6,7-tetrahydroindene]-1'-one |
| SMILES | CC12CCC3(C=C1CCC2=O)SCCS3 |
| InChI | InChI=1S/C12H16OS2/c1-11-4-5-12(14-6-7-15-12)8-9(11)2-3-10(11)13/h8H,2-7H2,1H3 |
| InChIKey | LWVWJTZAKFPYSG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|