C13H13ClN2O4 — CID 130338818
diethyl 3-chloro-1H-pyrrolo[2,3-b]pyridine-2,6-dicarboxylate (PubChem CID 130338818) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is diethyl 3-chloro-1H-pyrrolo[2,3-b]pyridine-2,6-dicarboxylate.
| Compound Name | diethyl 3-chloro-1H-pyrrolo[2,3-b]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 130338818 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | diethyl 3-chloro-1H-pyrrolo[2,3-b]pyridine-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2c(Cl)c(C(=O)OCC)[nH]c2n1 |
| InChI | InChI=1S/C13H13ClN2O4/c1-3-19-12(17)8-6-5-7-9(14)10(13(18)20-4-2)16-11(7)15-8/h5-6H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | KLRFVJJWZXIHFV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |