About 1-oxobutan-2-yl acetate
1-oxobutan-2-yl acetate (PubChem CID 13033921) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is 1-oxobutan-2-yl acetate.
Molecular Properties
| Compound Name | 1-oxobutan-2-yl acetate |
| PubChem CID | 13033921 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 1-oxobutan-2-yl acetate |
| SMILES | CCC(C=O)OC(C)=O |
| InChI | InChI=1S/C6H10O3/c1-3-6(4-7)9-5(2)8/h4,6H,3H2,1-2H3 |
| InChIKey | IYOJOSWOUUPBRK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-oxobutan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxobutan-2-yl acetate?
The IUPAC name of 1-oxobutan-2-yl acetate (CID 13033921) is 1-oxobutan-2-yl acetate.
What is the SMILES notation for 1-oxobutan-2-yl acetate?
The canonical SMILES for 1-oxobutan-2-yl acetate is CCC(C=O)OC(C)=O.
What is the InChIKey of 1-oxobutan-2-yl acetate?
The InChIKey is IYOJOSWOUUPBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-3-6(4-7)9-5(2)8/h4,6H,3H2,1-2H3.
What are the key properties of 1-oxobutan-2-yl acetate?
1-oxobutan-2-yl acetate has a molecular weight of 130.14 g/mol, XLogP of 0.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxobutan-2-yl acetate is sourced from PubChem (CID 13033921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).