About 2-tert-butyliminoethyl 2,2-dimethylpropanoate
2-tert-butyliminoethyl 2,2-dimethylpropanoate (PubChem CID 13033935) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-tert-butyliminoethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 2-tert-butyliminoethyl 2,2-dimethylpropanoate |
| PubChem CID | 13033935 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-tert-butyliminoethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)/N=C/COC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-10(2,3)9(13)14-8-7-12-11(4,5)6/h7H,8H2,1-6H3/b12-7+ |
| InChIKey | NROBMCRKVVGLCU-KPKJPENVSA-N |
| XLogP | 2.44 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyliminoethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyliminoethyl 2,2-dimethylpropanoate?
The IUPAC name of 2-tert-butyliminoethyl 2,2-dimethylpropanoate (CID 13033935) is 2-tert-butyliminoethyl 2,2-dimethylpropanoate.
What is the SMILES notation for 2-tert-butyliminoethyl 2,2-dimethylpropanoate?
The canonical SMILES for 2-tert-butyliminoethyl 2,2-dimethylpropanoate is CC(C)(C)/N=C/COC(=O)C(C)(C)C.
What is the InChIKey of 2-tert-butyliminoethyl 2,2-dimethylpropanoate?
The InChIKey is NROBMCRKVVGLCU-KPKJPENVSA-N. The full InChI is InChI=1S/C11H21NO2/c1-10(2,3)9(13)14-8-7-12-11(4,5)6/h7H,8H2,1-6H3/b12-7+.
What are the key properties of 2-tert-butyliminoethyl 2,2-dimethylpropanoate?
2-tert-butyliminoethyl 2,2-dimethylpropanoate has a molecular weight of 199.29 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyliminoethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 13033935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).