C18H18CuN4 — CID 130339696
copper;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine (PubChem CID 130339696) has the molecular formula C18H18CuN4 and a molecular weight of 353.92 g/mol. Its IUPAC name is copper;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine.
| Compound Name | copper;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 130339696 |
| Molecular Formula | C18H18CuN4 |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | copper;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine |
| SMILES | [Cu].c1ccc(CN(Cc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C18H18N4.Cu/c1-4-10-19-16(7-1)13-22(14-17-8-2-5-11-20-17)15-18-9-3-6-12-21-18;/h1-12H,13-15H2; |
| InChIKey | NSVJDTNULLTNNV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |