About ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate
ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate (PubChem CID 13033998) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate |
| PubChem CID | 13033998 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC2C=COC2C1 |
| InChI | InChI=1S/C9H11NO4/c1-2-12-9(11)6-5-8-7(14-10-6)3-4-13-8/h3-4,7-8H,2,5H2,1H3 |
| InChIKey | XNAGTJWQBCXSFQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate?
The IUPAC name of ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate (CID 13033998) is ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate.
What is the SMILES notation for ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate?
The canonical SMILES for ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate is CCOC(=O)C1=NOC2C=COC2C1.
What is the InChIKey of ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate?
The InChIKey is XNAGTJWQBCXSFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c1-2-12-9(11)6-5-8-7(14-10-6)3-4-13-8/h3-4,7-8H,2,5H2,1H3.
What are the key properties of ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate?
ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate has a molecular weight of 197.19 g/mol, XLogP of 0.61, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4a,7a-dihydro-4H-furo[2,3-e]oxazine-3-carboxylate is sourced from PubChem (CID 13033998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).