C32H36F3N7O2 — CID 130340162
N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(7-ethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 130340162) has the molecular formula C32H36F3N7O2 and a molecular weight of 607.68 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(7-ethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(7-ethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130340162 |
| Molecular Formula | C32H36F3N7O2 |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(7-ethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn4c5c(c(CC)ccc35)CCC4)n2)c(OC(F)(F)F)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C32H36F3N7O2/c1-6-20-10-11-22-23(19-42-14-8-9-21(20)30(22)42)24-12-13-36-31(38-24)39-26-17-25(37-29(43)7-2)27(41(5)16-15-40(3)4)18-28(26)44-32(33,34)35/h7,10-13,17-19H,2,6,8-9,14-16H2,1,3-5H3,(H,37,43)(H,36,38,39) |
| InChIKey | OLUFFRIDXAEZIL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|