C19H29N — CID 130340232
(3E,5E,7E)-N,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-imine (PubChem CID 130340232) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (3E,5E,7E)-N,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-imine.
| Compound Name | (3E,5E,7E)-N,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-imine |
|---|---|
| PubChem CID | 130340232 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (3E,5E,7E)-N,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-imine |
| SMILES | C/N=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C19H29N/c1-15(9-7-11-17(3)20-6)12-13-18-16(2)10-8-14-19(18,4)5/h7,9,11-13H,8,10,14H2,1-6H3/b11-7+,13-12+,15-9+,20-17+ |
| InChIKey | UAZABPBBPQTXDR-UPLONBLDSA-N |
| XLogP | 5.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|