C17H15FN2 — CID 130340466
2-[(3Z,5Z)-4-fluoroocta-1,3,5,7-tetraen-3-yl]-5-methylquinazoline (PubChem CID 130340466) has the molecular formula C17H15FN2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[(3Z,5Z)-4-fluoroocta-1,3,5,7-tetraen-3-yl]-5-methylquinazoline.
| Compound Name | 2-[(3Z,5Z)-4-fluoroocta-1,3,5,7-tetraen-3-yl]-5-methylquinazoline |
|---|---|
| PubChem CID | 130340466 |
| Molecular Formula | C17H15FN2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-[(3Z,5Z)-4-fluoroocta-1,3,5,7-tetraen-3-yl]-5-methylquinazoline |
| SMILES | C=C/C=C\C(F)=C(/C=C)c1ncc2c(C)cccc2n1 |
| InChI | InChI=1S/C17H15FN2/c1-4-6-9-15(18)13(5-2)17-19-11-14-12(3)8-7-10-16(14)20-17/h4-11H,1-2H2,3H3/b9-6-,15-13- |
| InChIKey | HSKCLZVRBOUPGP-LTBHIABHSA-N |
| XLogP | 4.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|