C22H23N5O2 — CID 130340606
5-benzyl-N-[(3S,4R)-1,4-dimethyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 130340606) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 5-benzyl-N-[(3S,4R)-1,4-dimethyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(3S,4R)-1,4-dimethyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 130340606 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 5-benzyl-N-[(3S,4R)-1,4-dimethyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2ccccc2N(C)C(=O)[C@H]1NC(=O)c1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C22H23N5O2/c1-14-12-16-10-6-7-11-17(16)27(2)22(29)19(14)24-21(28)20-23-18(25-26-20)13-15-8-4-3-5-9-15/h3-11,14,19H,12-13H2,1-2H3,(H,24,28)(H,23,25,26)/t14-,19+/m1/s1 |
| InChIKey | ZMFCYKGIDZFLBB-KUHUBIRLSA-N |
| XLogP | 2.35 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |