C23H28ClFN4O4S2 — CID 130340655
1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-N,N,2-trimethylindole-5-sulfonamide (PubChem CID 130340655) has the molecular formula C23H28ClFN4O4S2 and a molecular weight of 543.09 g/mol. Its IUPAC name is 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-N,N,2-trimethylindole-5-sulfonamide.
| Compound Name | 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-N,N,2-trimethylindole-5-sulfonamide |
|---|---|
| PubChem CID | 130340655 |
| Molecular Formula | C23H28ClFN4O4S2 |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 1-[(Z)-4-(chloroamino)-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-N,N,2-trimethylindole-5-sulfonamide |
| SMILES | Cc1c(-c2cccc(S(=O)(=O)N(C)C)c2)c2cc(S(=O)(=O)N(C)C)ccc2n1C/C(F)=C/CNCl |
| InChI | InChI=1S/C23H28ClFN4O4S2/c1-16-23(17-7-6-8-19(13-17)34(30,31)27(2)3)21-14-20(35(32,33)28(4)5)9-10-22(21)29(16)15-18(25)11-12-26-24/h6-11,13-14,26H,12,15H2,1-5H3/b18-11- |
| InChIKey | QQWVLWDFSUFAPD-WQRHYEAKSA-N |
| XLogP | 3.71 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|