C25H30N2O4 — CID 130341001
diethyl 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3,5-dimethyl-1-phenylpyrazine-2,6-dicarboxylate (PubChem CID 130341001) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is diethyl 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3,5-dimethyl-1-phenylpyrazine-2,6-dicarboxylate.
| Compound Name | diethyl 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3,5-dimethyl-1-phenylpyrazine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 130341001 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | diethyl 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3,5-dimethyl-1-phenylpyrazine-2,6-dicarboxylate |
| SMILES | C=C/C=C\C=C(/C)N1C(C)=C(C(=O)OCC)N(c2ccccc2)C(C(=O)OCC)=C1C |
| InChI | InChI=1S/C25H30N2O4/c1-7-10-12-15-18(4)26-19(5)22(24(28)30-8-2)27(21-16-13-11-14-17-21)23(20(26)6)25(29)31-9-3/h7,10-17H,1,8-9H2,2-6H3/b12-10-,18-15+ |
| InChIKey | WXRMDUMEODERBJ-HCMZBRDFSA-N |
| XLogP | 5.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|