C17H18FN — CID 130341015
2-[(2Z,4Z)-3-fluorohexa-2,4-dien-2-yl]-3,8-dimethylideneazecine (PubChem CID 130341015) has the molecular formula C17H18FN and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-[(2Z,4Z)-3-fluorohexa-2,4-dien-2-yl]-3,8-dimethylideneazecine.
| Compound Name | 2-[(2Z,4Z)-3-fluorohexa-2,4-dien-2-yl]-3,8-dimethylideneazecine |
|---|---|
| PubChem CID | 130341015 |
| Molecular Formula | C17H18FN |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-[(2Z,4Z)-3-fluorohexa-2,4-dien-2-yl]-3,8-dimethylideneazecine |
| SMILES | C=c1ccccc(=C)c(/C(C)=C(F)/C=C\C)ncc1 |
| InChI | InChI=1S/C17H18FN/c1-5-8-16(18)15(4)17-14(3)10-7-6-9-13(2)11-12-19-17/h5-12H,2-3H2,1,4H3/b8-5-,9-6-,10-7+,12-11+,16-15-,19-17+ |
| InChIKey | CWIURGORXKFGAO-YLHYETJBSA-N |
| XLogP | 3.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|