About 1-iodoethyl 2-octyldecanoate
1-iodoethyl 2-octyldecanoate (PubChem CID 130341553) has the molecular formula C20H39IO2
and a molecular weight of 438.43 g/mol. Its IUPAC name is 1-iodoethyl 2-octyldecanoate.
Molecular Properties
| Compound Name | 1-iodoethyl 2-octyldecanoate |
| PubChem CID | 130341553 |
| Molecular Formula | C20H39IO2 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1-iodoethyl 2-octyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)C(=O)OC(C)I |
| InChI | InChI=1S/C20H39IO2/c1-4-6-8-10-12-14-16-19(20(22)23-18(3)21)17-15-13-11-9-7-5-2/h18-19H,4-17H2,1-3H3 |
| InChIKey | GQKHIOPYOKDPGL-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodoethyl 2-octyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodoethyl 2-octyldecanoate?
The IUPAC name of 1-iodoethyl 2-octyldecanoate (CID 130341553) is 1-iodoethyl 2-octyldecanoate.
What is the SMILES notation for 1-iodoethyl 2-octyldecanoate?
The canonical SMILES for 1-iodoethyl 2-octyldecanoate is CCCCCCCCC(CCCCCCCC)C(=O)OC(C)I.
What is the InChIKey of 1-iodoethyl 2-octyldecanoate?
The InChIKey is GQKHIOPYOKDPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39IO2/c1-4-6-8-10-12-14-16-19(20(22)23-18(3)21)17-15-13-11-9-7-5-2/h18-19H,4-17H2,1-3H3.
What are the key properties of 1-iodoethyl 2-octyldecanoate?
1-iodoethyl 2-octyldecanoate has a molecular weight of 438.43 g/mol, XLogP of 7.43, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodoethyl 2-octyldecanoate is sourced from PubChem (CID 130341553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).