C8H11N3S — CID 130342880
5-methyl-3-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]-1H-1,2,4-triazole (PubChem CID 130342880) has the molecular formula C8H11N3S and a molecular weight of 181.26 g/mol. Its IUPAC name is 5-methyl-3-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]-1H-1,2,4-triazole.
| Compound Name | 5-methyl-3-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 130342880 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 5-methyl-3-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]-1H-1,2,4-triazole |
| SMILES | C=C/C(=C\SC)c1n[nH]c(C)n1 |
| InChI | InChI=1S/C8H11N3S/c1-4-7(5-12-3)8-9-6(2)10-11-8/h4-5H,1H2,2-3H3,(H,9,10,11)/b7-5+ |
| InChIKey | WSCPPYDTWUBPQE-FNORWQNLSA-N |
| XLogP | 2.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|