About 2-N,5-N-dimethoxyhexane-2,5-diimine
2-N,5-N-dimethoxyhexane-2,5-diimine (PubChem CID 13034305) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-N,5-N-dimethoxyhexane-2,5-diimine.
Molecular Properties
| Compound Name | 2-N,5-N-dimethoxyhexane-2,5-diimine |
| PubChem CID | 13034305 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-N,5-N-dimethoxyhexane-2,5-diimine |
| SMILES | CO/N=C(\C)CC/C(C)=N/OC |
| InChI | InChI=1S/C8H16N2O2/c1-7(9-11-3)5-6-8(2)10-12-4/h5-6H2,1-4H3/b9-7+,10-8+ |
| InChIKey | KWQJMTHYTPTFQA-FIFLTTCUSA-N |
| XLogP | 1.81 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,5-N-dimethoxyhexane-2,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-N-dimethoxyhexane-2,5-diimine?
The IUPAC name of 2-N,5-N-dimethoxyhexane-2,5-diimine (CID 13034305) is 2-N,5-N-dimethoxyhexane-2,5-diimine.
What is the SMILES notation for 2-N,5-N-dimethoxyhexane-2,5-diimine?
The canonical SMILES for 2-N,5-N-dimethoxyhexane-2,5-diimine is CO/N=C(\C)CC/C(C)=N/OC.
What is the InChIKey of 2-N,5-N-dimethoxyhexane-2,5-diimine?
The InChIKey is KWQJMTHYTPTFQA-FIFLTTCUSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-7(9-11-3)5-6-8(2)10-12-4/h5-6H2,1-4H3/b9-7+,10-8+.
What are the key properties of 2-N,5-N-dimethoxyhexane-2,5-diimine?
2-N,5-N-dimethoxyhexane-2,5-diimine has a molecular weight of 172.23 g/mol, XLogP of 1.81, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-N-dimethoxyhexane-2,5-diimine is sourced from PubChem (CID 13034305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).